About [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol
[(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol (PubChem CID 163544799) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol.
Analyze [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol?
The IUPAC name of [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol (CID 163544799) is [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol.
What is the SMILES notation for [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol?
The canonical SMILES for [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol is CO[C@H]1CC=CO[C@@H]1CO.
What is the InChIKey of [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol?
The InChIKey is FEDDZXAPAYAVLH-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H12O3/c1-9-6-3-2-4-10-7(6)5-8/h2,4,6-8H,3,5H2,1H3/t6-,7+/m0/s1.
What are the key properties of [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol?
[(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol has a molecular weight of 144.17 g/mol, XLogP of 0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-3-methoxy-3,4-dihydro-2H-pyran-2-yl]methanol is sourced from PubChem (CID 163544799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).