C22H22FN3O5S — CID 163550785
5-ethyl-2-[[4-[(4-fluorophenyl)methylsulfinyl]cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 163550785) has the molecular formula C22H22FN3O5S and a molecular weight of 459.50 g/mol. Its IUPAC name is 5-ethyl-2-[[4-[(4-fluorophenyl)methylsulfinyl]cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-ethyl-2-[[4-[(4-fluorophenyl)methylsulfinyl]cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 163550785 |
| Molecular Formula | C22H22FN3O5S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 5-ethyl-2-[[4-[(4-fluorophenyl)methylsulfinyl]cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCc1cc(=O)oc2nc(ON=C3CCC(S(=O)Cc4ccc(F)cc4)CC3)[nH]c(=O)c12 |
| InChI | InChI=1S/C22H22FN3O5S/c1-2-14-11-18(27)30-21-19(14)20(28)24-22(25-21)31-26-16-7-9-17(10-8-16)32(29)12-13-3-5-15(23)6-4-13/h3-6,11,17H,2,7-10,12H2,1H3,(H,24,25,28)/b26-16- |
| InChIKey | FIWKPJGHTJQKKD-QQXSKIMKSA-N |
| XLogP | 3.20 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|