C21H22N4O6S — CID 24742343
2-[(1-benzylsulfonylpiperidin-4-ylidene)amino]oxy-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 24742343) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-[(1-benzylsulfonylpiperidin-4-ylidene)amino]oxy-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-[(1-benzylsulfonylpiperidin-4-ylidene)amino]oxy-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24742343 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[(1-benzylsulfonylpiperidin-4-ylidene)amino]oxy-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCc1cc(=O)oc2nc(ON=C3CCN(S(=O)(=O)Cc4ccccc4)CC3)[nH]c(=O)c12 |
| InChI | InChI=1S/C21H22N4O6S/c1-2-15-12-17(26)30-20-18(15)19(27)22-21(23-20)31-24-16-8-10-25(11-9-16)32(28,29)13-14-6-4-3-5-7-14/h3-7,12H,2,8-11,13H2,1H3,(H,22,23,27) |
| InChIKey | VTRPJZVAULCTCF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|