C6H10N4 — CID 163552896
1-(3,5-dimethyl-1,2,4-triazol-4-yl)ethenamine (PubChem CID 163552896) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1,2,4-triazol-4-yl)ethenamine.
| Compound Name | 1-(3,5-dimethyl-1,2,4-triazol-4-yl)ethenamine |
|---|---|
| PubChem CID | 163552896 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1-(3,5-dimethyl-1,2,4-triazol-4-yl)ethenamine |
| SMILES | C=C(N)n1c(C)nnc1C |
| InChI | InChI=1S/C6H10N4/c1-4(7)10-5(2)8-9-6(10)3/h1,7H2,2-3H3 |
| InChIKey | FKNXYRDLAJPROD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |