C6H14N4 — CID 169246730
3,5-dimethyl-1,2,4-triazol-1-amine;ethane (PubChem CID 169246730) has the molecular formula C6H14N4 and a molecular weight of 142.21 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4-triazol-1-amine;ethane.
| Compound Name | 3,5-dimethyl-1,2,4-triazol-1-amine;ethane |
|---|---|
| PubChem CID | 169246730 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 3,5-dimethyl-1,2,4-triazol-1-amine;ethane |
| SMILES | CC.Cc1nc(C)n(N)n1 |
| InChI | InChI=1S/C4H8N4.C2H6/c1-3-6-4(2)8(5)7-3;1-2/h5H2,1-2H3;1-2H3 |
| InChIKey | ZBORGEYXINOBQH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |