C16H13N4O2S+ — CID 163556634
13-amino-5-(4-methoxyphenyl)-8-thia-3,5-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 163556634) has the molecular formula C16H13N4O2S+ and a molecular weight of 325.37 g/mol. Its IUPAC name is 13-amino-5-(4-methoxyphenyl)-8-thia-3,5-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-amino-5-(4-methoxyphenyl)-8-thia-3,5-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 163556634 |
| Molecular Formula | C16H13N4O2S+ |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 13-amino-5-(4-methoxyphenyl)-8-thia-3,5-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | COc1ccc(-n2cnc3c(sc4[nH+]ccc(N)c43)c2=O)cc1 |
| InChI | InChI=1S/C16H12N4O2S/c1-22-10-4-2-9(3-5-10)20-8-19-13-12-11(17)6-7-18-15(12)23-14(13)16(20)21/h2-8H,1H3,(H2,17,18)/p+1 |
| InChIKey | FNPPHVWDZWBPSN-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 84.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |