C18H15BrN4O3S — CID 23657242
12-bromo-13-(2-hydroxyethylamino)-5-(4-methoxyphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 23657242) has the molecular formula C18H15BrN4O3S and a molecular weight of 447.31 g/mol. Its IUPAC name is 12-bromo-13-(2-hydroxyethylamino)-5-(4-methoxyphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 12-bromo-13-(2-hydroxyethylamino)-5-(4-methoxyphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 23657242 |
| Molecular Formula | C18H15BrN4O3S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 12-bromo-13-(2-hydroxyethylamino)-5-(4-methoxyphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | COc1ccc(-n2cnc3c(sc4ncc(Br)c(NCCO)c43)c2=O)cc1 |
| InChI | InChI=1S/C18H15BrN4O3S/c1-26-11-4-2-10(3-5-11)23-9-22-15-13-14(20-6-7-24)12(19)8-21-17(13)27-16(15)18(23)25/h2-5,8-9,24H,6-7H2,1H3,(H,20,21) |
| InChIKey | IHCNENIPDWLDPY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |