C21H16N6O2S — CID 88987942
13-(3-aminoanilino)-5-(4-methoxyphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 88987942) has the molecular formula C21H16N6O2S and a molecular weight of 416.47 g/mol. Its IUPAC name is 13-(3-aminoanilino)-5-(4-methoxyphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-(3-aminoanilino)-5-(4-methoxyphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 88987942 |
| Molecular Formula | C21H16N6O2S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 13-(3-aminoanilino)-5-(4-methoxyphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | COc1ccc(-n2cnc3c(sc4ncnc(Nc5cccc(N)c5)c43)c2=O)cc1 |
| InChI | InChI=1S/C21H16N6O2S/c1-29-15-7-5-14(6-8-15)27-11-25-17-16-19(26-13-4-2-3-12(22)9-13)23-10-24-20(16)30-18(17)21(27)28/h2-11H,22H2,1H3,(H,23,24,26) |
| InChIKey | RRPVUWOLEUZOJX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|