About methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate
methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate (PubChem CID 163561626) has the molecular formula C20H18I2O4
and a molecular weight of 576.17 g/mol. Its IUPAC name is methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate |
| PubChem CID | 163561626 |
| Molecular Formula | C20H18I2O4 |
| Molecular Weight | 576.17 g/mol |
| Exact Mass | 575.93 |
| IUPAC Name | methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate |
| SMILES | COC(=O)Cc1coc2cc(OCc3ccc(I)cc3I3CC3)ccc12 |
| InChI | InChI=1S/C20H18I2O4/c1-24-20(23)8-14-12-26-19-10-16(4-5-17(14)19)25-11-13-2-3-15(21)9-18(13)22-6-7-22/h2-5,9-10,12H,6-8,11H2,1H3 |
| InChIKey | FRRQLTHGKKBIEN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.17 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate?
The IUPAC name of methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate (CID 163561626) is methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate.
What is the SMILES notation for methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate?
The canonical SMILES for methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate is COC(=O)Cc1coc2cc(OCc3ccc(I)cc3I3CC3)ccc12.
What is the InChIKey of methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate?
The InChIKey is FRRQLTHGKKBIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18I2O4/c1-24-20(23)8-14-12-26-19-10-16(4-5-17(14)19)25-11-13-2-3-15(21)9-18(13)22-6-7-22/h2-5,9-10,12H,6-8,11H2,1H3.
What are the key properties of methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate?
methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate has a molecular weight of 576.17 g/mol, XLogP of 5.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[6-[[4-iodo-2-(1λ3-iodiran-1-yl)phenyl]methoxy]-1-benzofuran-3-yl]acetate is sourced from PubChem (CID 163561626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).