C17H25N5O2 — CID 163564060
N-[[3-[2-(4-nitrophenyl)ethyl]-1H-1,2,4-triazol-5-yl]methyl]-N-propylpropan-1-amine (PubChem CID 163564060) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[[3-[2-(4-nitrophenyl)ethyl]-1H-1,2,4-triazol-5-yl]methyl]-N-propylpropan-1-amine.
| Compound Name | N-[[3-[2-(4-nitrophenyl)ethyl]-1H-1,2,4-triazol-5-yl]methyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 163564060 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-[[3-[2-(4-nitrophenyl)ethyl]-1H-1,2,4-triazol-5-yl]methyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)Cc1nc(CCc2ccc([N+](=O)[O-])cc2)n[nH]1 |
| InChI | InChI=1S/C17H25N5O2/c1-3-11-21(12-4-2)13-17-18-16(19-20-17)10-7-14-5-8-15(9-6-14)22(23)24/h5-6,8-9H,3-4,7,10-13H2,1-2H3,(H,18,19,20) |
| InChIKey | FTRNZSWZNKDYGD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|