C20H24N8O2 — CID 163568582
N-[3-[6-(pyridin-3-ylmethylamino)purin-9-yl]cyclobutyl]morpholine-4-carboxamide (PubChem CID 163568582) has the molecular formula C20H24N8O2 and a molecular weight of 408.47 g/mol. Its IUPAC name is N-[3-[6-(pyridin-3-ylmethylamino)purin-9-yl]cyclobutyl]morpholine-4-carboxamide.
| Compound Name | N-[3-[6-(pyridin-3-ylmethylamino)purin-9-yl]cyclobutyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 163568582 |
| Molecular Formula | C20H24N8O2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[3-[6-(pyridin-3-ylmethylamino)purin-9-yl]cyclobutyl]morpholine-4-carboxamide |
| SMILES | O=C(NC1CC(n2cnc3c(NCc4cccnc4)ncnc32)C1)N1CCOCC1 |
| InChI | InChI=1S/C20H24N8O2/c29-20(27-4-6-30-7-5-27)26-15-8-16(9-15)28-13-25-17-18(23-12-24-19(17)28)22-11-14-2-1-3-21-10-14/h1-3,10,12-13,15-16H,4-9,11H2,(H,26,29)(H,22,23,24) |
| InChIKey | FXHBYNDUYFLYIJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |