C15H12F8O2 — CID 163572063
2-(1,1-difluoroethyl)-4,4,5-trifluoro-2-methyl-5-(trifluoromethyl)-1,3-dioxolane;octa-2,4,6-triyne (PubChem CID 163572063) has the molecular formula C15H12F8O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-4,4,5-trifluoro-2-methyl-5-(trifluoromethyl)-1,3-dioxolane;octa-2,4,6-triyne.
| Compound Name | 2-(1,1-difluoroethyl)-4,4,5-trifluoro-2-methyl-5-(trifluoromethyl)-1,3-dioxolane;octa-2,4,6-triyne |
|---|---|
| PubChem CID | 163572063 |
| Molecular Formula | C15H12F8O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-(1,1-difluoroethyl)-4,4,5-trifluoro-2-methyl-5-(trifluoromethyl)-1,3-dioxolane;octa-2,4,6-triyne |
| SMILES | CC#CC#CC#CC.CC(F)(F)C1(C)OC(F)(F)C(F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C8H6.C7H6F8O2/c1-3-5-7-8-6-4-2;1-3(8,9)4(2)16-5(10,6(11,12)13)7(14,15)17-4/h1-2H3;1-2H3 |
| InChIKey | GAFSDJQEZTUZNQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|