C24H31N5O2 — CID 163576630
tert-butyl 4-[[[5-(1H-indol-6-ylamino)-3-pyridinyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 163576630) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is tert-butyl 4-[[[5-(1H-indol-6-ylamino)-3-pyridinyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[5-(1H-indol-6-ylamino)-3-pyridinyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163576630 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | tert-butyl 4-[[[5-(1H-indol-6-ylamino)-3-pyridinyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNc2cncc(Nc3ccc4cc[nH]c4c3)c2)CC1 |
| InChI | InChI=1S/C24H31N5O2/c1-24(2,3)31-23(30)29-10-7-17(8-11-29)14-27-20-12-21(16-25-15-20)28-19-5-4-18-6-9-26-22(18)13-19/h4-6,9,12-13,15-17,26-28H,7-8,10-11,14H2,1-3H3 |
| InChIKey | GEAZKAGXSZCYDR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |