C23H30F3NO4 — CID 163580027
7-[(2R)-2-[(2R)-2-hydroxy-3-[3-(trifluoromethyl)phenyl]propyl]-5-oxo-4-azaspiro[2.4]heptan-4-yl]heptanoic acid (PubChem CID 163580027) has the molecular formula C23H30F3NO4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 7-[(2R)-2-[(2R)-2-hydroxy-3-[3-(trifluoromethyl)phenyl]propyl]-5-oxo-4-azaspiro[2.4]heptan-4-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(2R)-2-hydroxy-3-[3-(trifluoromethyl)phenyl]propyl]-5-oxo-4-azaspiro[2.4]heptan-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 163580027 |
| Molecular Formula | C23H30F3NO4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 7-[(2R)-2-[(2R)-2-hydroxy-3-[3-(trifluoromethyl)phenyl]propyl]-5-oxo-4-azaspiro[2.4]heptan-4-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC12C[C@@H]2C[C@@H](O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H30F3NO4/c24-23(25,26)17-7-5-6-16(12-17)13-19(28)14-18-15-22(18)10-9-20(29)27(22)11-4-2-1-3-8-21(30)31/h5-7,12,18-19,28H,1-4,8-11,13-15H2,(H,30,31)/t18-,19-,22?/m0/s1 |
| InChIKey | GGTDZIHTHVOHBA-NVPCEHRXSA-N |
| XLogP | 4.42 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|