About [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene
[4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene (PubChem CID 163581148) has the molecular formula C8H17IN2
and a molecular weight of 268.14 g/mol. Its IUPAC name is [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene.
Molecular Properties
| Compound Name | [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene |
| PubChem CID | 163581148 |
| Molecular Formula | C8H17IN2 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene |
| SMILES | [H]/N=N/C1CCC(I(C)C)CC1 |
| InChI | InChI=1S/C8H17IN2/c1-9(2)7-3-5-8(11-10)6-4-7/h7-8,10H,3-6H2,1-2H3/b11-10+ |
| InChIKey | GHQCYABELHIITD-ZHACJKMWSA-N |
| XLogP | 3.09 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene?
The IUPAC name of [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene (CID 163581148) is [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene.
What is the SMILES notation for [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene?
The canonical SMILES for [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene is [H]/N=N/C1CCC(I(C)C)CC1.
What is the InChIKey of [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene?
The InChIKey is GHQCYABELHIITD-ZHACJKMWSA-N. The full InChI is InChI=1S/C8H17IN2/c1-9(2)7-3-5-8(11-10)6-4-7/h7-8,10H,3-6H2,1-2H3/b11-10+.
What are the key properties of [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene?
[4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene has a molecular weight of 268.14 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(dimethyl-λ3-iodanyl)cyclohexyl]diazene is sourced from PubChem (CID 163581148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).