C16H32N8O — CID 176539263
1-[4-[5-[4-(diaminomethylideneamino)cyclohexyl]-1,3,4-oxadiazolidin-2-yl]cyclohexyl]guanidine (PubChem CID 176539263) has the molecular formula C16H32N8O and a molecular weight of 352.49 g/mol. Its IUPAC name is 1-[4-[5-[4-(diaminomethylideneamino)cyclohexyl]-1,3,4-oxadiazolidin-2-yl]cyclohexyl]guanidine.
| Compound Name | 1-[4-[5-[4-(diaminomethylideneamino)cyclohexyl]-1,3,4-oxadiazolidin-2-yl]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 176539263 |
| Molecular Formula | C16H32N8O |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 1-[4-[5-[4-(diaminomethylideneamino)cyclohexyl]-1,3,4-oxadiazolidin-2-yl]cyclohexyl]guanidine |
| SMILES | [H]/N=C(\N)NC1CCC(C2NNC(C3CCC(N=C(N)N)CC3)O2)CC1 |
| InChI | InChI=1S/C16H32N8O/c17-15(18)21-11-5-1-9(2-6-11)13-23-24-14(25-13)10-3-7-12(8-4-10)22-16(19)20/h9-14,23-24H,1-8H2,(H4,17,18,21)(H4,19,20,22) |
| InChIKey | MDXMMYKNEUMCLB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 159.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|