C36H31BN2O3 — CID 163582626
2-phenyl-9-[9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]-1,2-dihydro-1,10-phenanthroline (PubChem CID 163582626) has the molecular formula C36H31BN2O3 and a molecular weight of 550.47 g/mol. Its IUPAC name is 2-phenyl-9-[9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]-1,2-dihydro-1,10-phenanthroline.
| Compound Name | 2-phenyl-9-[9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]-1,2-dihydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 163582626 |
| Molecular Formula | C36H31BN2O3 |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 2-phenyl-9-[9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]-1,2-dihydro-1,10-phenanthroline |
| SMILES | CC1(C)OB(c2cccc3oc4ccc(-c5ccc6ccc7c(c6n5)NC(c5ccccc5)C=C7)cc4c23)OC1(C)C |
| InChI | InChI=1S/C36H31BN2O3/c1-35(2)36(3,4)42-37(41-35)27-11-8-12-31-32(27)26-21-25(17-20-30(26)40-31)29-19-16-24-14-13-23-15-18-28(22-9-6-5-7-10-22)38-33(23)34(24)39-29/h5-21,28,38H,1-4H3 |
| InChIKey | GIVJZUIXBBDBPJ-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|