C21H27N5O5 — CID 163588544
N-(6-aminohexyl)-2-[2-(6-imino-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide (PubChem CID 163588544) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-[2-(6-imino-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide.
| Compound Name | N-(6-aminohexyl)-2-[2-(6-imino-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 163588544 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-(6-aminohexyl)-2-[2-(6-imino-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
| SMILES | [H]/N=C1\CCC(N2C(=O)c3cccc(OCC(=O)NCCCCCCN)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H27N5O5/c22-10-3-1-2-4-11-24-17(27)12-31-15-7-5-6-13-18(15)21(30)26(20(13)29)14-8-9-16(23)25-19(14)28/h5-7,14H,1-4,8-12,22H2,(H,24,27)(H2,23,25,28) |
| InChIKey | GNOLCYIRMIOHFY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|