C26H26N4O — CID 163591913
6-(3-methoxyphenyl)-N-methyl-8-(3-methylbut-2-enyl)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 163591913) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-N-methyl-8-(3-methylbut-2-enyl)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | 6-(3-methoxyphenyl)-N-methyl-8-(3-methylbut-2-enyl)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 163591913 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 6-(3-methoxyphenyl)-N-methyl-8-(3-methylbut-2-enyl)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CNc1nc(-c2cccnc2)nc2c(CC=C(C)C)cc(-c3cccc(OC)c3)cc12 |
| InChI | InChI=1S/C26H26N4O/c1-17(2)10-11-19-13-21(18-7-5-9-22(14-18)31-4)15-23-24(19)29-25(30-26(23)27-3)20-8-6-12-28-16-20/h5-10,12-16H,11H2,1-4H3,(H,27,29,30) |
| InChIKey | GQFAHVHGKWXHKL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|