C30H23ClN4O4 — CID 163592496
2-chloro-5-[5-[(Z)-[1-(3-cyanocyclohexa-1,3-dien-1-yl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-N-(3-methoxyphenyl)benzamide (PubChem CID 163592496) has the molecular formula C30H23ClN4O4 and a molecular weight of 538.99 g/mol. Its IUPAC name is 2-chloro-5-[5-[(Z)-[1-(3-cyanocyclohexa-1,3-dien-1-yl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-N-(3-methoxyphenyl)benzamide.
| Compound Name | 2-chloro-5-[5-[(Z)-[1-(3-cyanocyclohexa-1,3-dien-1-yl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 163592496 |
| Molecular Formula | C30H23ClN4O4 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 2-chloro-5-[5-[(Z)-[1-(3-cyanocyclohexa-1,3-dien-1-yl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2cc(-c3ccc(/C=C4\C(=O)N(C5=CC(C#N)=CCC5)N=C4C)o3)ccc2Cl)c1 |
| InChI | InChI=1S/C30H23ClN4O4/c1-18-25(30(37)35(34-18)22-7-3-5-19(13-22)17-32)16-24-10-12-28(39-24)20-9-11-27(31)26(14-20)29(36)33-21-6-4-8-23(15-21)38-2/h4-6,8-16H,3,7H2,1-2H3,(H,33,36)/b25-16- |
| InChIKey | GQRBHAQZATYGRI-XYGWBWBKSA-N |
| XLogP | 6.59 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|