About [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate
[2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate (PubChem CID 163594363) has the molecular formula C15H29N3O4
and a molecular weight of 315.41 g/mol. Its IUPAC name is [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate |
| PubChem CID | 163594363 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate |
| SMILES | [H]/N=C/CNNC(=O)OCC(CC)(CC)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H29N3O4/c1-6-15(7-2,10-21-12(19)14(3,4)5)11-22-13(20)18-17-9-8-16/h8,16-17H,6-7,9-11H2,1-5H3,(H,18,20)/b16-8+ |
| InChIKey | GSDJSTVJAQBFJR-LZYBPNLTSA-N |
| XLogP | 2.26 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate?
The IUPAC name of [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate (CID 163594363) is [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate?
The canonical SMILES for [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate is [H]/N=C/CNNC(=O)OCC(CC)(CC)COC(=O)C(C)(C)C.
What is the InChIKey of [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate?
The InChIKey is GSDJSTVJAQBFJR-LZYBPNLTSA-N. The full InChI is InChI=1S/C15H29N3O4/c1-6-15(7-2,10-21-12(19)14(3,4)5)11-22-13(20)18-17-9-8-16/h8,16-17H,6-7,9-11H2,1-5H3,(H,18,20)/b16-8+.
What are the key properties of [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate?
[2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate has a molecular weight of 315.41 g/mol, XLogP of 2.26, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-ethyl-2-[(2-iminoethylamino)carbamoyloxymethyl]butyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 163594363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).