C8H11N — CID 163598015
spiro[2-azabicyclo[1.1.0]butane-4,2'-bicyclo[2.2.0]hexane] (PubChem CID 163598015) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is spiro[2-azabicyclo[1.1.0]butane-4,2'-bicyclo[2.2.0]hexane].
| Compound Name | spiro[2-azabicyclo[1.1.0]butane-4,2'-bicyclo[2.2.0]hexane] |
|---|---|
| PubChem CID | 163598015 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | spiro[2-azabicyclo[1.1.0]butane-4,2'-bicyclo[2.2.0]hexane] |
| SMILES | C1CC2C1CC21C2NC21 |
| InChI | InChI=1S/C8H11N/c1-2-5-4(1)3-8(5)6-7(8)9-6/h4-7,9H,1-3H2 |
| InChIKey | GVDXYLPFIUBEAW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|