C13H28N4O3 — CID 163605177
2-ethyl-5-[[N'-(3-methoxypropoxymethyl)carbamimidoyl]amino]pentanamide (PubChem CID 163605177) has the molecular formula C13H28N4O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-ethyl-5-[[N'-(3-methoxypropoxymethyl)carbamimidoyl]amino]pentanamide.
| Compound Name | 2-ethyl-5-[[N'-(3-methoxypropoxymethyl)carbamimidoyl]amino]pentanamide |
|---|---|
| PubChem CID | 163605177 |
| Molecular Formula | C13H28N4O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-ethyl-5-[[N'-(3-methoxypropoxymethyl)carbamimidoyl]amino]pentanamide |
| SMILES | CCC(CCCNC(N)=NCOCCCOC)C(N)=O |
| InChI | InChI=1S/C13H28N4O3/c1-3-11(12(14)18)6-4-7-16-13(15)17-10-20-9-5-8-19-2/h11H,3-10H2,1-2H3,(H2,14,18)(H3,15,16,17) |
| InChIKey | PMIWWDLXQSZOJA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|