C17H13ClO4Se — CID 163609282
2,6-diphenylselenopyran-1-ium perchlorate (PubChem CID 163609282) has the molecular formula C17H13ClO4Se and a molecular weight of 395.70 g/mol. Its IUPAC name is 2,6-diphenylselenopyran-1-ium perchlorate.
| Compound Name | 2,6-diphenylselenopyran-1-ium perchlorate |
|---|---|
| PubChem CID | 163609282 |
| Molecular Formula | C17H13ClO4Se |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 2,6-diphenylselenopyran-1-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cccc(-c3ccccc3)[se+]2)cc1 |
| InChI | InChI=1S/C17H13Se.ClHO4/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15;2-1(3,4)5/h1-13H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HEMUUIVRBLVSIF-UHFFFAOYSA-M |
| XLogP | -0.40 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|