C22H34Si — CID 163611138
2-(cyclohexen-1-yl)ethynyl-triethylsilane;1-ethynylcyclohexene (PubChem CID 163611138) has the molecular formula C22H34Si and a molecular weight of 326.60 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)ethynyl-triethylsilane;1-ethynylcyclohexene.
| Compound Name | 2-(cyclohexen-1-yl)ethynyl-triethylsilane;1-ethynylcyclohexene |
|---|---|
| PubChem CID | 163611138 |
| Molecular Formula | C22H34Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 2-(cyclohexen-1-yl)ethynyl-triethylsilane;1-ethynylcyclohexene |
| SMILES | C#CC1=CCCCC1.CC[Si](C#CC1=CCCCC1)(CC)CC |
| InChI | InChI=1S/C14H24Si.C8H10/c1-4-15(5-2,6-3)13-12-14-10-8-7-9-11-14;1-2-8-6-4-3-5-7-8/h10H,4-9,11H2,1-3H3;1,6H,3-5,7H2 |
| InChIKey | HFZZVUHWKFRKMY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|