C12H21N4+ — CID 163615925
(1-amino-5,6-diimino-3,7-dimethyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)azanium (PubChem CID 163615925) has the molecular formula C12H21N4+ and a molecular weight of 221.33 g/mol. Its IUPAC name is (1-amino-5,6-diimino-3,7-dimethyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)azanium.
| Compound Name | (1-amino-5,6-diimino-3,7-dimethyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)azanium |
|---|---|
| PubChem CID | 163615925 |
| Molecular Formula | C12H21N4+ |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (1-amino-5,6-diimino-3,7-dimethyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)azanium |
| SMILES | [H]/N=C1C(=N\[H])\C(C)=CC2C\1CC(C)C([NH3+])C2N |
| InChI | InChI=1S/C12H20N4/c1-5-3-7-8(11(15)9(5)13)4-6(2)10(14)12(7)16/h3,6-8,10,12-13,15H,4,14,16H2,1-2H3/p+1/b13-9+,15-11- |
| InChIKey | HKAMPOQXYCXZBA-KUFLNFLFSA-O |
| XLogP | 0.20 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|