C23H29N7O4S — CID 163621946
19-(aminomethylidene)-6-(oxan-4-yl)-13-oxo-13λ4-thia-3,6,7,10,17,24-hexazatricyclo[18.3.1.04,8]tetracosa-1(23),4,7,17,20(24),21-hexaene-2,9-dione (PubChem CID 163621946) has the molecular formula C23H29N7O4S and a molecular weight of 499.60 g/mol. Its IUPAC name is 19-(aminomethylidene)-6-(oxan-4-yl)-13-oxo-13λ4-thia-3,6,7,10,17,24-hexazatricyclo[18.3.1.04,8]tetracosa-1(23),4,7,17,20(24),21-hexaene-2,9-dione.
| Compound Name | 19-(aminomethylidene)-6-(oxan-4-yl)-13-oxo-13λ4-thia-3,6,7,10,17,24-hexazatricyclo[18.3.1.04,8]tetracosa-1(23),4,7,17,20(24),21-hexaene-2,9-dione |
|---|---|
| PubChem CID | 163621946 |
| Molecular Formula | C23H29N7O4S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 19-(aminomethylidene)-6-(oxan-4-yl)-13-oxo-13λ4-thia-3,6,7,10,17,24-hexazatricyclo[18.3.1.04,8]tetracosa-1(23),4,7,17,20(24),21-hexaene-2,9-dione |
| SMILES | NC=C1/C=N/CCCS(=O)CCNC(=O)c2nn(C3CCOCC3)cc2NC(=O)c2cccc1n2 |
| InChI | InChI=1S/C23H29N7O4S/c24-13-16-14-25-7-2-11-35(33)12-8-26-23(32)21-20(15-30(29-21)17-5-9-34-10-6-17)28-22(31)19-4-1-3-18(16)27-19/h1,3-4,13-15,17H,2,5-12,24H2,(H,26,32)(H,28,31)/b16-13?,25-14+ |
| InChIKey | GKYJXFXXVYSDGO-BZMPBLHCSA-N |
| XLogP | 1.13 |
| TPSA | 153.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |