About bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate
bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate (PubChem CID 163639194) has the molecular formula C8H17NO5
and a molecular weight of 207.23 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate |
| PubChem CID | 163639194 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate |
| SMILES | CC(=O)C(=O)[O-].C[NH+](CCO)CCO |
| InChI | InChI=1S/C5H13NO2.C3H4O3/c1-6(2-4-7)3-5-8;1-2(4)3(5)6/h7-8H,2-5H2,1H3;1H3,(H,5,6) |
| InChIKey | ICSMOONJITXUOU-UHFFFAOYSA-N |
| XLogP | -4.19 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate?
The IUPAC name of bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate (CID 163639194) is bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate.
What is the SMILES notation for bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate?
The canonical SMILES for bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate is CC(=O)C(=O)[O-].C[NH+](CCO)CCO.
What is the InChIKey of bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate?
The InChIKey is ICSMOONJITXUOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.C3H4O3/c1-6(2-4-7)3-5-8;1-2(4)3(5)6/h7-8H,2-5H2,1H3;1H3,(H,5,6).
What are the key properties of bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate?
bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate has a molecular weight of 207.23 g/mol, XLogP of -4.19, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl)-methylazanium;2-oxopropanoate is sourced from PubChem (CID 163639194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).