C20H17N — CID 163644240
6-deuterio-1,6-diphenyl-5,7-dihydrocyclopenta[c]pyridine (PubChem CID 163644240) has the molecular formula C20H17N and a molecular weight of 272.37 g/mol. Its IUPAC name is 6-deuterio-1,6-diphenyl-5,7-dihydrocyclopenta[c]pyridine.
| Compound Name | 6-deuterio-1,6-diphenyl-5,7-dihydrocyclopenta[c]pyridine |
|---|---|
| PubChem CID | 163644240 |
| Molecular Formula | C20H17N |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 6-deuterio-1,6-diphenyl-5,7-dihydrocyclopenta[c]pyridine |
| SMILES | [2H]C1(c2ccccc2)Cc2ccnc(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C20H17N/c1-3-7-15(8-4-1)18-13-17-11-12-21-20(19(17)14-18)16-9-5-2-6-10-16/h1-12,18H,13-14H2/i18D |
| InChIKey | WRXCQAQHJMEUFI-VAAKKRCDSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |