C32H10Cl4N4O2 — CID 163647100
2-[(2Z)-5,6-dichloro-2-[[4-[(Z)-[5,6-dichloro-1-(dicyanomethylidene)-3-oxoinden-2-ylidene]methyl]phenyl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 163647100) has the molecular formula C32H10Cl4N4O2 and a molecular weight of 624.27 g/mol. Its IUPAC name is 2-[(2Z)-5,6-dichloro-2-[[4-[(Z)-[5,6-dichloro-1-(dicyanomethylidene)-3-oxoinden-2-ylidene]methyl]phenyl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-5,6-dichloro-2-[[4-[(Z)-[5,6-dichloro-1-(dicyanomethylidene)-3-oxoinden-2-ylidene]methyl]phenyl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 163647100 |
| Molecular Formula | C32H10Cl4N4O2 |
| Molecular Weight | 624.27 g/mol |
| Exact Mass | 621.96 |
| IUPAC Name | 2-[(2Z)-5,6-dichloro-2-[[4-[(Z)-[5,6-dichloro-1-(dicyanomethylidene)-3-oxoinden-2-ylidene]methyl]phenyl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C/c2ccc(/C=C3\C(=O)c4cc(Cl)c(Cl)cc4C3=C(C#N)C#N)cc2)C(=O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C32H10Cl4N4O2/c33-25-7-19-21(9-27(25)35)31(41)23(29(19)17(11-37)12-38)5-15-1-2-16(4-3-15)6-24-30(18(13-39)14-40)20-8-26(34)28(36)10-22(20)32(24)42/h1-10H/b23-5-,24-6- |
| InChIKey | IJDRCJPUNGHKBN-XIBKSJEISA-N |
| XLogP | 8.46 |
| TPSA | 129.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.27 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|