C25H30FN9O2 — CID 163647594
N-[(5R)-2-[4-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]-1,3,5-triazin-2-yl]-1-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 163647594) has the molecular formula C25H30FN9O2 and a molecular weight of 507.57 g/mol. Its IUPAC name is N-[(5R)-2-[4-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]-1,3,5-triazin-2-yl]-1-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-[(5R)-2-[4-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]-1,3,5-triazin-2-yl]-1-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 163647594 |
| Molecular Formula | C25H30FN9O2 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | N-[(5R)-2-[4-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]-1,3,5-triazin-2-yl]-1-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | C/N=C/C(=CN)Nc1ncnc(-c2ccc3c(c2F)CCCC[C@H]3NC(=O)c2noc(C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C25H30FN9O2/c1-25(2,3)23-33-21(35-37-23)22(36)32-18-8-6-5-7-16-15(18)9-10-17(19(16)26)20-29-13-30-24(34-20)31-14(11-27)12-28-4/h9-13,18H,5-8,27H2,1-4H3,(H,32,36)(H,29,30,31,34)/b14-11?,28-12+/t18-/m1/s1 |
| InChIKey | CJZVRCQTCDUOJQ-AEGICKNZSA-N |
| XLogP | 3.47 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|