C16H22N2O7 — CID 163651840
(3-methyl-2,6-dinitro-4-octan-4-ylphenyl) hydrogen carbonate (PubChem CID 163651840) has the molecular formula C16H22N2O7 and a molecular weight of 354.36 g/mol. Its IUPAC name is (3-methyl-2,6-dinitro-4-octan-4-ylphenyl) hydrogen carbonate.
| Compound Name | (3-methyl-2,6-dinitro-4-octan-4-ylphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 163651840 |
| Molecular Formula | C16H22N2O7 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (3-methyl-2,6-dinitro-4-octan-4-ylphenyl) hydrogen carbonate |
| SMILES | CCCCC(CCC)c1cc([N+](=O)[O-])c(OC(=O)O)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C16H22N2O7/c1-4-6-8-11(7-5-2)12-9-13(17(21)22)15(25-16(19)20)14(10(12)3)18(23)24/h9,11H,4-8H2,1-3H3,(H,19,20) |
| InChIKey | IMWPRCHCKWFICJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|