C8H10N6O2 — CID 163654867
5-amino-1-(2-aminoethyl)pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 163654867) has the molecular formula C8H10N6O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is 5-amino-1-(2-aminoethyl)pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-(2-aminoethyl)pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163654867 |
| Molecular Formula | C8H10N6O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 5-amino-1-(2-aminoethyl)pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | NCCn1c(=O)[nH]c(=O)c2c(N)ncnc21 |
| InChI | InChI=1S/C8H10N6O2/c9-1-2-14-6-4(5(10)11-3-12-6)7(15)13-8(14)16/h3H,1-2,9H2,(H2,10,11,12)(H,13,15,16) |
| InChIKey | IPILVVHYRPQMJA-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |