C8H9BrO — CID 163656047
(6R)-2-bromo-6-methylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 163656047) has the molecular formula C8H9BrO and a molecular weight of 201.06 g/mol. Its IUPAC name is (6R)-2-bromo-6-methylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | (6R)-2-bromo-6-methylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 163656047 |
| Molecular Formula | C8H9BrO |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (6R)-2-bromo-6-methylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | C[C@@H]1CC=CC(Br)=C1C=O |
| InChI | InChI=1S/C8H9BrO/c1-6-3-2-4-8(9)7(6)5-10/h2,4-6H,3H2,1H3/t6-/m1/s1 |
| InChIKey | IQHSUWDZVBJPJR-ZCFIWIBFSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|