C8H9BrO — CID 125469365
(1S,4S)-3-bromobicyclo[2.2.1]hept-2-ene-2-carbaldehyde (PubChem CID 125469365) has the molecular formula C8H9BrO and a molecular weight of 201.06 g/mol. Its IUPAC name is (1S,4S)-3-bromobicyclo[2.2.1]hept-2-ene-2-carbaldehyde.
| Compound Name | (1S,4S)-3-bromobicyclo[2.2.1]hept-2-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 125469365 |
| Molecular Formula | C8H9BrO |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (1S,4S)-3-bromobicyclo[2.2.1]hept-2-ene-2-carbaldehyde |
| SMILES | O=CC1=C(Br)[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H9BrO/c9-8-6-2-1-5(3-6)7(8)4-10/h4-6H,1-3H2/t5-,6-/m0/s1 |
| InChIKey | FHNXCGLEAXILAY-WDSKDSINSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|