C8H7N3O2 — CID 174762144
6-cyclopropyl-1,3,5-triazine-2,4-dicarbaldehyde (PubChem CID 174762144) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 6-cyclopropyl-1,3,5-triazine-2,4-dicarbaldehyde.
| Compound Name | 6-cyclopropyl-1,3,5-triazine-2,4-dicarbaldehyde |
|---|---|
| PubChem CID | 174762144 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 6-cyclopropyl-1,3,5-triazine-2,4-dicarbaldehyde |
| SMILES | O=Cc1nc(C=O)nc(C2CC2)n1 |
| InChI | InChI=1S/C8H7N3O2/c12-3-6-9-7(4-13)11-8(10-6)5-1-2-5/h3-5H,1-2H2 |
| InChIKey | ICTPWRRVADFZQW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|