C8H8BrNOS — CID 84705591
2-bromo-5-cyclobutyl-1,3-thiazole-4-carbaldehyde (PubChem CID 84705591) has the molecular formula C8H8BrNOS and a molecular weight of 246.13 g/mol. Its IUPAC name is 2-bromo-5-cyclobutyl-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-bromo-5-cyclobutyl-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 84705591 |
| Molecular Formula | C8H8BrNOS |
| Molecular Weight | 246.13 g/mol |
| Exact Mass | 244.95 |
| IUPAC Name | 2-bromo-5-cyclobutyl-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1nc(Br)sc1C1CCC1 |
| InChI | InChI=1S/C8H8BrNOS/c9-8-10-6(4-11)7(12-8)5-2-1-3-5/h4-5H,1-3H2 |
| InChIKey | XIZWHPIOXLABTR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|