C9H10BrNOS — CID 84710146
2-bromo-5-cyclopentyl-1,3-thiazole-4-carbaldehyde (PubChem CID 84710146) has the molecular formula C9H10BrNOS and a molecular weight of 260.16 g/mol. Its IUPAC name is 2-bromo-5-cyclopentyl-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-bromo-5-cyclopentyl-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 84710146 |
| Molecular Formula | C9H10BrNOS |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 2-bromo-5-cyclopentyl-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1nc(Br)sc1C1CCCC1 |
| InChI | InChI=1S/C9H10BrNOS/c10-9-11-7(5-12)8(13-9)6-3-1-2-4-6/h5-6H,1-4H2 |
| InChIKey | ZWDVVKLFWDXDPX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|