C28H45BN4O4 — CID 163663723
methyl N-[(3S)-2-methyl-4-[(2S)-2-[5-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]pentan-3-yl]carbamate (PubChem CID 163663723) has the molecular formula C28H45BN4O4 and a molecular weight of 512.50 g/mol. Its IUPAC name is methyl N-[(3S)-2-methyl-4-[(2S)-2-[5-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]pentan-3-yl]carbamate.
| Compound Name | methyl N-[(3S)-2-methyl-4-[(2S)-2-[5-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 163663723 |
| Molecular Formula | C28H45BN4O4 |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | methyl N-[(3S)-2-methyl-4-[(2S)-2-[5-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]pentan-3-yl]carbamate |
| SMILES | COC(=O)N[C@@H](C(C)C)C(C)N1CCC[C@H]1C1=NCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2C)N1 |
| InChI | InChI=1S/C28H45BN4O4/c1-17(2)24(32-26(34)35-9)19(4)33-14-10-11-23(33)25-30-16-22(31-25)21-13-12-20(15-18(21)3)29-36-27(5,6)28(7,8)37-29/h12-13,15,17,19,22-24H,10-11,14,16H2,1-9H3,(H,30,31)(H,32,34)/t19?,22?,23-,24-/m0/s1 |
| InChIKey | IWOIFKMNJPJIMG-NXZXNMDISA-N |
| XLogP | 3.57 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|