C26H28N2O4 — CID 163665002
N-(4-butylphenyl)-4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)methyl]benzamide (PubChem CID 163665002) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)methyl]benzamide.
| Compound Name | N-(4-butylphenyl)-4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 163665002 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-(4-butylphenyl)-4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)methyl]benzamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccc(CN3C(=O)C4C5CCC(O5)C4C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-2-3-4-16-7-11-19(12-8-16)27-24(29)18-9-5-17(6-10-18)15-28-25(30)22-20-13-14-21(32-20)23(22)26(28)31/h5-12,20-23H,2-4,13-15H2,1H3,(H,27,29) |
| InChIKey | IXPREDYISJXYDP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|