C25H24ClN3O7 — CID 163665891
(2S)-2-[[2-chloro-4-[[(3,5-dihydroxybenzoyl)amino]methyl]benzoyl]amino]-3-[[hydroxy(phenyl)methyl]amino]propanoic acid (PubChem CID 163665891) has the molecular formula C25H24ClN3O7 and a molecular weight of 513.93 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-4-[[(3,5-dihydroxybenzoyl)amino]methyl]benzoyl]amino]-3-[[hydroxy(phenyl)methyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-chloro-4-[[(3,5-dihydroxybenzoyl)amino]methyl]benzoyl]amino]-3-[[hydroxy(phenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 163665891 |
| Molecular Formula | C25H24ClN3O7 |
| Molecular Weight | 513.93 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (2S)-2-[[2-chloro-4-[[(3,5-dihydroxybenzoyl)amino]methyl]benzoyl]amino]-3-[[hydroxy(phenyl)methyl]amino]propanoic acid |
| SMILES | O=C(NCc1ccc(C(=O)N[C@@H](CNC(O)c2ccccc2)C(=O)O)c(Cl)c1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C25H24ClN3O7/c26-20-8-14(12-27-23(33)16-9-17(30)11-18(31)10-16)6-7-19(20)24(34)29-21(25(35)36)13-28-22(32)15-4-2-1-3-5-15/h1-11,21-22,28,30-32H,12-13H2,(H,27,33)(H,29,34)(H,35,36)/t21-,22?/m0/s1 |
| InChIKey | IYKLUAGUFDCECK-HMTLIYDFSA-N |
| XLogP | 2.14 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.93 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|