C10H22N2O6 — CID 163668162
8-(2-aminoethylamino)-4,5,6,7,8-pentahydroxyoctan-3-one (PubChem CID 163668162) has the molecular formula C10H22N2O6 and a molecular weight of 266.29 g/mol. Its IUPAC name is 8-(2-aminoethylamino)-4,5,6,7,8-pentahydroxyoctan-3-one.
| Compound Name | 8-(2-aminoethylamino)-4,5,6,7,8-pentahydroxyoctan-3-one |
|---|---|
| PubChem CID | 163668162 |
| Molecular Formula | C10H22N2O6 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 8-(2-aminoethylamino)-4,5,6,7,8-pentahydroxyoctan-3-one |
| SMILES | CCC(=O)C(O)C(O)C(O)C(O)C(O)NCCN |
| InChI | InChI=1S/C10H22N2O6/c1-2-5(13)6(14)7(15)8(16)9(17)10(18)12-4-3-11/h6-10,12,14-18H,2-4,11H2,1H3 |
| InChIKey | JAFWNXQVDDXKFR-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|