C24H31FO6 — CID 163676238
(3R,4S,5R,7R,9R,10S)-5-fluoro-7,10-dihydroxy-3,7,9,13-tetramethyl-4-phenylmethoxy-1-oxacyclotetradeca-11,12-diene-2,6-dione (PubChem CID 163676238) has the molecular formula C24H31FO6 and a molecular weight of 434.50 g/mol. Its IUPAC name is (3R,4S,5R,7R,9R,10S)-5-fluoro-7,10-dihydroxy-3,7,9,13-tetramethyl-4-phenylmethoxy-1-oxacyclotetradeca-11,12-diene-2,6-dione.
| Compound Name | (3R,4S,5R,7R,9R,10S)-5-fluoro-7,10-dihydroxy-3,7,9,13-tetramethyl-4-phenylmethoxy-1-oxacyclotetradeca-11,12-diene-2,6-dione |
|---|---|
| PubChem CID | 163676238 |
| Molecular Formula | C24H31FO6 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (3R,4S,5R,7R,9R,10S)-5-fluoro-7,10-dihydroxy-3,7,9,13-tetramethyl-4-phenylmethoxy-1-oxacyclotetradeca-11,12-diene-2,6-dione |
| SMILES | CC1=C=C[C@@H](O)[C@H](C)C[C@@](C)(O)C(=O)[C@H](F)[C@@H](OCc2ccccc2)[C@@H](C)C(=O)OC1 |
| InChI | InChI=1S/C24H31FO6/c1-15-10-11-19(26)16(2)12-24(4,29)22(27)20(25)21(17(3)23(28)31-13-15)30-14-18-8-6-5-7-9-18/h5-9,11,16-17,19-21,26,29H,12-14H2,1-4H3/t10?,16-,17-,19-,20-,21+,24-/m1/s1 |
| InChIKey | JGYHSJPHMLFPPZ-NJJISTIKSA-N |
| XLogP | 2.91 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |