C27H20N4O7S — CID 163683137
(2S)-3-[4-(7-amino-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-2-[(3-sulfonylindole-2-carbonyl)amino]propanoic acid (PubChem CID 163683137) has the molecular formula C27H20N4O7S and a molecular weight of 544.55 g/mol. Its IUPAC name is (2S)-3-[4-(7-amino-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-2-[(3-sulfonylindole-2-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-[4-(7-amino-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-2-[(3-sulfonylindole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 163683137 |
| Molecular Formula | C27H20N4O7S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | (2S)-3-[4-(7-amino-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-2-[(3-sulfonylindole-2-carbonyl)amino]propanoic acid |
| SMILES | Nc1ccc2c(c1)C(=O)N(c1ccc(C[C@H](NC(=O)C3=Nc4ccccc4C3=S(=O)=O)C(=O)O)cc1)C(=O)C2 |
| InChI | InChI=1S/C27H20N4O7S/c28-16-8-7-15-12-22(32)31(26(34)19(15)13-16)17-9-5-14(6-10-17)11-21(27(35)36)30-25(33)23-24(39(37)38)18-3-1-2-4-20(18)29-23/h1-10,13,21H,11-12,28H2,(H,30,33)(H,35,36)/t21-/m0/s1 |
| InChIKey | MPMKSXIBHBQAJG-NRFANRHFSA-N |
| XLogP | 1.30 |
| TPSA | 176.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|