C27H30N4O5S — CID 163501643
3-[4-(8-amino-8-imino-2-oxooctyl)phenyl]-2-[[3-[methylidene(oxo)-λ6-sulfanylidene]indole-2-carbonyl]amino]propanoic acid (PubChem CID 163501643) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is 3-[4-(8-amino-8-imino-2-oxooctyl)phenyl]-2-[[3-[methylidene(oxo)-λ6-sulfanylidene]indole-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[4-(8-amino-8-imino-2-oxooctyl)phenyl]-2-[[3-[methylidene(oxo)-λ6-sulfanylidene]indole-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 163501643 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 3-[4-(8-amino-8-imino-2-oxooctyl)phenyl]-2-[[3-[methylidene(oxo)-λ6-sulfanylidene]indole-2-carbonyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)CCCCCC(=O)Cc1ccc(CC(NC(=O)C2=Nc3ccccc3C2=S(=C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-37(36)25-20-8-5-6-9-21(20)30-24(25)26(33)31-22(27(34)35)16-18-13-11-17(12-14-18)15-19(32)7-3-2-4-10-23(28)29/h5-6,8-9,11-14,22H,1-4,7,10,15-16H2,(H3,28,29)(H,31,33)(H,34,35) |
| InChIKey | NDLJPMMQXKAMHP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 162.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|