C28H29N3O5S3 — CID 163859375
2-[[3-[methylidene(oxo)-λ6-sulfanylidene]indole-2-carbonyl]amino]-5-oxo-5-[2-(2-piperidin-4-ylethyl)thieno[2,3-b]thiophen-5-yl]pentanoic acid (PubChem CID 163859375) has the molecular formula C28H29N3O5S3 and a molecular weight of 583.76 g/mol. Its IUPAC name is 2-[[3-[methylidene(oxo)-λ6-sulfanylidene]indole-2-carbonyl]amino]-5-oxo-5-[2-(2-piperidin-4-ylethyl)thieno[2,3-b]thiophen-5-yl]pentanoic acid.
| Compound Name | 2-[[3-[methylidene(oxo)-λ6-sulfanylidene]indole-2-carbonyl]amino]-5-oxo-5-[2-(2-piperidin-4-ylethyl)thieno[2,3-b]thiophen-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 163859375 |
| Molecular Formula | C28H29N3O5S3 |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 2-[[3-[methylidene(oxo)-λ6-sulfanylidene]indole-2-carbonyl]amino]-5-oxo-5-[2-(2-piperidin-4-ylethyl)thieno[2,3-b]thiophen-5-yl]pentanoic acid |
| SMILES | C=S(=O)=C1C(C(=O)NC(CCC(=O)c2cc3cc(CCC4CCNCC4)sc3s2)C(=O)O)=Nc2ccccc21 |
| InChI | InChI=1S/C28H29N3O5S3/c1-39(36)25-19-4-2-3-5-20(19)30-24(25)26(33)31-21(27(34)35)8-9-22(32)23-15-17-14-18(37-28(17)38-23)7-6-16-10-12-29-13-11-16/h2-5,14-16,21,29H,1,6-13H2,(H,31,33)(H,34,35) |
| InChIKey | PDEVWHIUXASGPP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|