C15H24FN3 — CID 163685226
(1Z)-2-N-(4-fluorocyclohepta-1,5-dien-1-yl)-2-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,2,3-triamine (PubChem CID 163685226) has the molecular formula C15H24FN3 and a molecular weight of 265.38 g/mol. Its IUPAC name is (1Z)-2-N-(4-fluorocyclohepta-1,5-dien-1-yl)-2-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,2,3-triamine.
| Compound Name | (1Z)-2-N-(4-fluorocyclohepta-1,5-dien-1-yl)-2-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,2,3-triamine |
|---|---|
| PubChem CID | 163685226 |
| Molecular Formula | C15H24FN3 |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (1Z)-2-N-(4-fluorocyclohepta-1,5-dien-1-yl)-2-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,2,3-triamine |
| SMILES | C=C(N)/C(=C/NC(C)C)N(C)C1=CCC(F)C=CC1 |
| InChI | InChI=1S/C15H24FN3/c1-11(2)18-10-15(12(3)17)19(4)14-7-5-6-13(16)8-9-14/h5-6,9-11,13,18H,3,7-8,17H2,1-2,4H3/b15-10- |
| InChIKey | JOHJEXXJWUAAEY-GDNBJRDFSA-N |
| XLogP | 2.80 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|