C13H22F2N2 — CID 173219290
1-N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-2-N,2-N-diethylpropane-1,2-diamine (PubChem CID 173219290) has the molecular formula C13H22F2N2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-2-N,2-N-diethylpropane-1,2-diamine.
| Compound Name | 1-N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-2-N,2-N-diethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 173219290 |
| Molecular Formula | C13H22F2N2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-2-N,2-N-diethylpropane-1,2-diamine |
| SMILES | CCN(CC)C(C)CNC1(F)C=CC(F)=CC1 |
| InChI | InChI=1S/C13H22F2N2/c1-4-17(5-2)11(3)10-16-13(15)8-6-12(14)7-9-13/h6-8,11,16H,4-5,9-10H2,1-3H3 |
| InChIKey | WYANYQCPTKVQEJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|