C12H12N4O4 — CID 163685563
methyl N-[(3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methylideneamino]carbamate (PubChem CID 163685563) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is methyl N-[(3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methylideneamino]carbamate.
| Compound Name | methyl N-[(3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 163685563 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl N-[(3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methylideneamino]carbamate |
| SMILES | COC(=O)NN=Cc1c(C)[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C12H12N4O4/c1-8-11(7-13-14-12(17)20-2)16(19)10-6-4-3-5-9(10)15(8)18/h3-7H,1-2H3,(H,14,17) |
| InChIKey | JOODWJXLRIMVMC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|