C14H16N4O4 — CID 135764871
tert-butyl N-[(E)-(1,4-dioxidoquinoxaline-1,4-diium-2-yl)methylideneamino]carbamate (PubChem CID 135764871) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is tert-butyl N-[(E)-(1,4-dioxidoquinoxaline-1,4-diium-2-yl)methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-(1,4-dioxidoquinoxaline-1,4-diium-2-yl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 135764871 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | tert-butyl N-[(E)-(1,4-dioxidoquinoxaline-1,4-diium-2-yl)methylideneamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C/c1c[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C14H16N4O4/c1-14(2,3)22-13(19)16-15-8-10-9-17(20)11-6-4-5-7-12(11)18(10)21/h4-9H,1-3H3,(H,16,19)/b15-8+ |
| InChIKey | PNLPDUJTKWJOBJ-OVCLIPMQSA-N |
| XLogP | 0.97 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|